Benzamide,N-(2-amino-2-oxoethyl)-4-methoxy structure
|
Common Name | Benzamide,N-(2-amino-2-oxoethyl)-4-methoxy | ||
|---|---|---|---|---|
| CAS Number | 143153-70-2 | Molecular Weight | 208.214 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 487.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.5±24.6 °C | |
| Name | N-(2-Amino-2-oxoethyl)-4-methoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.3±30.0 °C at 760 mmHg |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.214 |
| Flash Point | 248.5±24.6 °C |
| Exact Mass | 208.084793 |
| PSA | 82.41000 |
| LogP | 0.31 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | ZKADLOGPYJUFCB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NCC(N)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-Amino-2-oxoethyl)-4-methoxybenzamide |
| Benzamide, N-(2-amino-2-oxoethyl)-4-methoxy- |
| N1-(2-amino-2-oxoethyl)-4-methoxybenzamide |
| hms1446a16 |
| Benzamide,N-(2-amino-2-oxoethyl)-4-methoxy |