Pyridin-4-amine, 3,5-dichloro-2-trichloromethyl- structure
|
Common Name | Pyridin-4-amine, 3,5-dichloro-2-trichloromethyl- | ||
|---|---|---|---|---|
| CAS Number | 14321-05-2 | Molecular Weight | 280.36600 | |
| Density | 1.75g/cm3 | Boiling Point | 347.4ºC at 760mmHg | |
| Molecular Formula | C6H3Cl5N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.9ºC | |
| Name | 3,5-dichloro-2-(trichloromethyl)pyridin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 347.4ºC at 760mmHg |
| Molecular Formula | C6H3Cl5N2 |
| Molecular Weight | 280.36600 |
| Flash Point | 163.9ºC |
| Exact Mass | 277.87400 |
| PSA | 38.91000 |
| LogP | 4.37850 |
| Vapour Pressure | 5.41E-05mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | WEYZLTAYNCBWFI-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cnc(C(Cl)(Cl)Cl)c1Cl |
| HS Code | 2933399090 |
|---|
|
~95%
Pyridin-4-amine... CAS#:14321-05-2 |
| Literature: Ovchinnikov, V.G.; Nasyr, I.A.; Litvinenko, G.S.; Maksimeno, N.M.; Zatsarevnyi, V.M. J. Appl. Chem. USSR (Engl. Transl.), 1991 , vol. 64, # 12 p. 2490 - 2497,2327 - 2334 |
|
~%
Pyridin-4-amine... CAS#:14321-05-2 |
| Literature: Ovchinnikov, V.G.; Nasyr, I.A.; Litvinenko, G.S.; Maksimeno, N.M.; Zatsarevnyi, V.M. J. Appl. Chem. USSR (Engl. Transl.), 1991 , vol. 64, # 12 p. 2490 - 2497,2327 - 2334 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-Dichloro-2-(trichloromethyl)-4-pyridinamine |
| Pyridin-4-amine,3,5-dichloro-2-trichloromethyl |
| HMS2684H03 |
| 3,5-dichloro-2-trichloromethyl-pyridin-4-ylamine |
| T0514-2523 |
| 4-Amino-3,5-dichlor-2-(trichlormethyl)pyridin |