Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate structure
|
Common Name | Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate | ||
|---|---|---|---|---|
| CAS Number | 143218-48-8 | Molecular Weight | 214.60000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H8ClNaO5S | Melting Point | 256ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Sodium 3-chloro-2-hydroxypropanesulphonate hemihydrate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 256ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C3H8ClNaO5S |
| Molecular Weight | 214.60000 |
| Exact Mass | 213.96800 |
| PSA | 95.04000 |
| LogP | 0.14780 |
| InChIKey | ZPFGAXXLEFTBEU-UHFFFAOYSA-M |
| SMILES | O.O=S(=O)([O-])CC(O)CCl.[Na+] |
| Water Solubility | Soluble in water. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Consequences of the nanoporosity of cellulosic fibers on their streaming potential and their interactions with cationic polyelectrolytes. Hubbe MA, et al.
Cellulose 14(6) , 655-71, (2007)
|
|
|
Charge and the dry-strength performance of polyampholytes: Part 2. Colloidal effects. Hubbe MA, et al.
Colloids Surf. A. Physicochem. Eng. Asp. 301(1) , 23-32, (2007)
|
| Sodium 3-chloro-2-hydroxypropanesulfonate hemihydrate |
| sodium,3-chloro-2-hydroxypropane-1-sulfonate,hydrate |
| MFCD00149699 |
| EINECS 204-807-0 |