2,2,2-Trichloroethyl 3,5-Dihydroxybenzoate
Modify Date: 2025-08-25 08:16:32
2,2,2-Trichloroethyl 3,5-Dihydroxybenzoate structure
|
Common Name | 2,2,2-Trichloroethyl 3,5-Dihydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 143330-91-0 | Molecular Weight | 285.50800 | |
| Density | 1.632g/cm3 | Boiling Point | 447.3ºC at 760 mmHg | |
| Molecular Formula | C9H7Cl3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | α-Resorcylic Acid 2,2,2-Trichloroethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 447.3ºC at 760 mmHg |
| Molecular Formula | C9H7Cl3O4 |
| Molecular Weight | 285.50800 |
| Flash Point | 224.3ºC |
| Exact Mass | 283.94100 |
| PSA | 66.76000 |
| LogP | 2.62480 |
| Vapour Pressure | 1.29E-08mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | UJFDPTHAQUCMRW-UHFFFAOYSA-N |
| SMILES | O=C(OCC(Cl)(Cl)Cl)c1cc(O)cc(O)c1 |
| Storage condition | 2-8°C |
| RIDADR | UN 1593 6.1/PG 3 |
|---|---|
| HS Code | 2918290000 |
|
~63%
2,2,2-Trichloro... CAS#:143330-91-0 |
| Literature: Huang, Diyun; Chen, Baoquan Patent: US2004/132960 A1, 2004 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:143330-92-1| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| MFCD02093462 |
| 2,2,2-Trichloroethyl 3,5-Dihydroxybenzoate |
| 3,5-DIHYDROXYBENZOIC ACID 2,2,2-TRICHLOROETHYL ESTER |