2-[[2,2-diethoxyethyl(methyl)amino]methyl]benzaldehyde structure
|
Common Name | 2-[[2,2-diethoxyethyl(methyl)amino]methyl]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 143426-14-6 | Molecular Weight | 265.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2,2-diethoxyethyl(methyl)amino]methyl]benzaldehyde |
|---|
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.34800 |
| Exact Mass | 265.16800 |
| PSA | 38.77000 |
| LogP | 2.33000 |
| InChIKey | WCTBAKLGODGNFC-UHFFFAOYSA-N |
| SMILES | CCOC(CN(C)Cc1ccccc1C=O)OCC |
|
~%
2-[[2,2-diethox... CAS#:143426-14-6 |
| Literature: Simig, Gyula Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 13 p. 1613 - 1616 |
|
~%
2-[[2,2-diethox... CAS#:143426-14-6 |
| Literature: Simig, Gyula Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 13 p. 1613 - 1616 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |