TAPI-0 (TNF alpha processing inhibitor-0) structure
|
Common Name | TAPI-0 (TNF alpha processing inhibitor-0) | ||
|---|---|---|---|---|
| CAS Number | 143457-40-3 | Molecular Weight | 456.535 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H32N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TAPI-0 (TNF alpha processing inhibitor-0)Inhibits TNF-α processing. Also a general matrix metalloprotease and TACE inhibitor. |
| Name | tapi-0 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.535 |
| Exact Mass | 456.237274 |
| PSA | 150.62000 |
| LogP | 1.31 |
| Index of Refraction | 1.587 |
| InChIKey | CRCPLBFLOSEABN-VBSNWNEZSA-N |
| SMILES | CC(C)CC(CC(=O)NO)C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(C)C(N)=O |
| L-Alaninamide, N-[2-[2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-(2-naphthalenyl)-L-alanyl- |
| N-{2-[2-(Hydroxyamino)-2-oxoethyl]-4-methylpentanoyl}-3-(2-naphthyl)-L-alanyl-L-alaninamide |