TAPI-0 structure
|
Common Name | TAPI-0 | ||
|---|---|---|---|---|
| CAS Number | 163958-73-4 | Molecular Weight | 456.53 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H32N4O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of TAPI-0TAPI-0 is a TACE (TNF-α converting enzyme; ADAM17) inhibitor with an IC50 of 100 nM. TAPI-0 is a MMP inhibitor and also attenuates TNF-α processing[1][2]. |
| Name | TAPI 0 |
|---|---|
| Synonym | More Synonyms |
| Description | TAPI-0 is a TACE (TNF-α converting enzyme; ADAM17) inhibitor with an IC50 of 100 nM. TAPI-0 is a MMP inhibitor and also attenuates TNF-α processing[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 100 nM (TACE)[2] |
| In Vitro | TAPI-0 inhibits peptide deformylase (PDF) with an IC50 of 18 nM. TAPI-0 suppresses chlamydial growth by targeting the bacterial PDF[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.53 |
| Exact Mass | 456.237274 |
| LogP | 1.31 |
| Index of Refraction | 1.587 |
| InChIKey | CRCPLBFLOSEABN-BEVDRBHNSA-N |
| SMILES | CC(C)CC(CC(=O)NO)C(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(C)C(N)=O |
| Water Solubility | Soluble to 10 (mg/mL) in DMSO |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 + P330 |
| RIDADR | UN 2811 6.1 / PGIII |
| N-[(2R)-2-[2-(Hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-(2-naphthalenyl)-L-alanyl-L-alaninamide |
| TAPI-0 |
| TNF-α Protease Inhibitor-0 |
| N-(R)-(2-(Hydroxyaminocarbonyl)Methyl)-4-Methylpentanoyl-L-Naphthylalanyl-L-Alanine amide |
| MFCD02684279 |
| TNF-α Processing Inhibitor-0 |