(6-bromo-1H-pyrrolo[2,3-b]pyridin-1-yl)(phenyl)methanone structure
|
Common Name | (6-bromo-1H-pyrrolo[2,3-b]pyridin-1-yl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 143468-12-6 | Molecular Weight | 301.138 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 363.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H9BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.9±25.9 °C | |
| Name | (6-bromopyrrolo[2,3-b]pyridin-1-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.9±35.0 °C at 760 mmHg |
| Molecular Formula | C14H9BrN2O |
| Molecular Weight | 301.138 |
| Flash Point | 173.9±25.9 °C |
| Exact Mass | 299.989807 |
| PSA | 34.89000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | KYNMLVATSZKHBD-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)n1ccc2ccc(Br)nc21 |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
|
~63%
(6-bromo-1H-pyr... CAS#:143468-12-6 |
| Literature: AC Immune, S.A. Patent: US2011/280808 A1, 2011 ; Location in patent: Page/Page column 39 ; |
|
~%
(6-bromo-1H-pyr... CAS#:143468-12-6 |
| Literature: WO2011/128455 A1, ; WO 2011/128455 A1 |
|
~%
(6-bromo-1H-pyr... CAS#:143468-12-6 |
| Literature: WO2011/128455 A1, ; WO 2011/128455 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methanone, (6-bromo-1H-pyrrolo[2,3-b]pyridin-1-yl)phenyl- |
| 1-Benzoyl-6-bromo-1H-pyrrolo<2,3-b>pyridine |
| 1H-Pyrrolo[2,3-b]pyridine,1-benzoyl-6-bromo |
| (6-Bromo-1H-pyrrolo[2,3-b]pyridin-1-yl)(phenyl)methanone |
| 1-Benzoyl-6-bromo-7-azaindole |
| (6-Bromo-pyrrolo[2,3-b]pyridin-1-yl)-phenyl-methanone |