4-Methyl-2-(2'-nitrophenyl)azophenol structure
|
Common Name | 4-Methyl-2-(2'-nitrophenyl)azophenol | ||
|---|---|---|---|---|
| CAS Number | 1435-71-8 | Molecular Weight | 257.24500 | |
| Density | 1.31g/cm3 | Boiling Point | 422.5ºC at 760mmHg | |
| Molecular Formula | C13H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | 4-Methyl-2-(2'-nitrophenyl)azophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760mmHg |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.24500 |
| Flash Point | 209.3ºC |
| Exact Mass | 257.08000 |
| PSA | 90.77000 |
| LogP | 4.54740 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | DRPPFIRCBMBJCM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(N=Nc2ccccc2[N+](=O)[O-])c1 |
| HS Code | 2927000090 |
|---|
|
~74%
4-Methyl-2-(2'-... CAS#:1435-71-8 |
| Literature: Farkas, Renata; Toerincsi, Mercedesz; Kolonits, Pal; Fekete, Jenoe; Alonso, Oscar Jimenez; Novak, Lajos Central European Journal of Chemistry, 2010 , vol. 8, # 2 p. 300 - 307 |
|
~%
4-Methyl-2-(2'-... CAS#:1435-71-8 |
| Literature: Goldschmidt; Brubacher Chemische Berichte, 1891 , vol. 24, p. 2313 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Hydroxy-5-methyl-2'-nitroazobenzene |
| 2-nitro-2'-hydroxy-5'-methylphenylazobenzene |
| 2-nitro-2'-hydroxy-5'-methylazobenzene |