L 012 sodium salt structure
|
Common Name | L 012 sodium salt | ||
|---|---|---|---|---|
| CAS Number | 143556-24-5 | Molecular Weight | 310.671 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8ClN4NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L 012 sodium saltL 012 sodium salt a luminol-based chemiluminescent (CL) probe, is widely used in vitro and in vivo to detect NADPH oxidase (Nox)-derived superoxide (O2•−) and identify Nox inhibitors[1]. |
| Name | L 012 sodium salt |
|---|---|
| Synonym | More Synonyms |
| Description | L 012 sodium salt a luminol-based chemiluminescent (CL) probe, is widely used in vitro and in vivo to detect NADPH oxidase (Nox)-derived superoxide (O2•−) and identify Nox inhibitors[1]. |
|---|---|
| Related Catalog | |
| In Vitro | L-012 sodium salt, a chemical analog of luminol, gives rise to significantly higher luminescence yield and increased sensitivity as compared to other CL probes, lucigenin and MCLA[1]. |
| In Vivo | L-012 sodium salt is well distributed in the mouse body and mediates a strong ROS/RNS-dependent luminescent signal in vivo and is useful for monitoring the development and regulation of inflammation in living organisms[2]. |
| References |
| Molecular Formula | C13H8ClN4NaO2 |
|---|---|
| Molecular Weight | 310.671 |
| Exact Mass | 310.023346 |
| InChIKey | IGEUYSJHQQCEFP-UHFFFAOYSA-M |
| SMILES | Nc1c(-c2ccccc2)nc(Cl)c2c([O-])nnc([O-])c12.[H+].[Na+] |
| MFCD30378369 |
| MFCD27991293 |
| Pyrido[3,4-d]pyridazin-1(2H)-one, 8-amino-5-chloro-4-hydroxy-7-phenyl-, sodium salt (1:1) |
| Sodium 8-amino-5-chloro-1-oxo-7-phenyl-1,2-dihydropyrido[3,4-d]pyridazin-4-olate |