Psilocine-d10
Psilocine-d10 structure
|
Common Name | Psilocine-d10 | ||
|---|---|---|---|---|
| CAS Number | 1435934-64-7 | Molecular Weight | 214.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 48.2 °F | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Psilocine-d10 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O |
|---|---|
| Molecular Weight | 214.33 |
| InChIKey | SPCIYGNTAMCTRO-HXOHQZFQSA-N |
| SMILES | CN(C)CCc1c[nH]c2cccc(O)c12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol |
| Flash Point(F) | 48.2 °F |
| Flash Point(C) | 9 °C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Metabolic stability in human liver microsomes assessed as intrinsic clearance measure...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4828617
|
|
Name: Metabolic stability in human liver microsomes assessed as half life measured after 60...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4828618
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Psilocine-d10? |
| A: Molecular weight of Psilocine-d10 is 214.33. |
| Q: What is the Chinese name of 1435934-64-7? |
| A: Chinese name of 1435934-64-7 is 1435934-64-7. |
| Q: What is the molecular formula of Psilocine-d10? |
| A: Molecular formula of Psilocine-d10 is C12H16N2O. |
| Q: What is the InChIKey of Psilocine-d10? |
| A: InChIKey of Psilocine-d10 is SPCIYGNTAMCTRO-HXOHQZFQSA-N. |
| Q: What is the English name of Psilocine-d10? |
| A: The English name of Psilocine-d10 is Psilocine-d10. |
| Q: What is the CAS number of Psilocine-d10? |
| A: CAS number of Psilocine-d10 is 1435934-64-7. |
| Q: What is the SMILES notation of Psilocine-d10? |
| A: SMILES notation of Psilocine-d10 is CN(C)CCc1c[nH]c2cccc(O)c12. |