[(2R)-pyrrolidin-2-yl]methanol,hydrochloride structure
|
Common Name | [(2R)-pyrrolidin-2-yl]methanol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 143767-55-9 | Molecular Weight | 137.60800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2R)-pyrrolidin-2-yl]methanol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H12ClNO |
|---|---|
| Molecular Weight | 137.60800 |
| Exact Mass | 137.06100 |
| PSA | 32.26000 |
| LogP | 0.86150 |
| InChIKey | NXSLBAAENZSPFI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2CN1C(C)=O |
| HS Code | 2933499090 |
|---|
|
~73%
[(2R)-pyrrolidi... CAS#:143767-55-9 |
| Literature: Kammermeier; Lerch; Sommer Synthesis, 1992 , # 11 p. 1157 - 1160 |
|
~43%
[(2R)-pyrrolidi... CAS#:143767-55-9 |
| Literature: Ho, Bin; Michael Crider; Stables, James P European Journal of Medicinal Chemistry, 2001 , vol. 36, # 3 p. 265 - 286 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| dimethyl 2-acetyl-1,2,3,4-tetrahydroisoquinoline-3,3-dicarboxylate |
| dimethyl 2-acetyl-1,2,3,4-tetrahydro-3,3-isoquinolinedicarboxylate |