Chromafenozide structure
|
Common Name | Chromafenozide | ||
|---|---|---|---|---|
| CAS Number | 143807-66-3 | Molecular Weight | 394.50700 | |
| Density | 1.129g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H30N2O3 | Melting Point | 186.4° | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of ChromafenozideChromafenozide is a lepidopteran insecticide; it is highly effective in controlling various lepidopteran pests. |
| Name | chromafenozide |
|---|---|
| Synonym | More Synonyms |
| Description | Chromafenozide is a lepidopteran insecticide; it is highly effective in controlling various lepidopteran pests. |
|---|---|
| Related Catalog |
| Density | 1.129g/cm3 |
|---|---|
| Melting Point | 186.4° |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.50700 |
| Exact Mass | 394.22600 |
| PSA | 58.64000 |
| LogP | 4.91340 |
| Index of Refraction | 1.574 |
| InChIKey | HPNSNYBUADCFDR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2C)CCCO3)C(C)(C)C)c1 |
| Storage condition | 0-6°C |
| 3,4-dihydro-5-methyl-2H-1-benzopyran-6-carboxylic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide |
| N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-5-methyl-3,4-dihydro-2H-chromene-6-carbohydrazide |
| 2'-tert-Butyl-5-methyl-2'-(3,5-xyloyl)chromane-6-carbohydrazide |
| Chromafenozide |
| N’-tert-butyl-N’-(3,5-dimethylbenzoyl)-5-methyl-3,4-dihydro-2H-1-benzopyran-6-carbohydrazide |
| N’-tert-butyl-5-methyl-N’-(3,5-xyloyl)chromane-6-carbohydrazide |