2-bromo-5-methyl-4-nitrophenol structure
|
Common Name | 2-bromo-5-methyl-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 14401-60-6 | Molecular Weight | 232.03100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-5-methyl-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6BrNO3 |
|---|---|
| Molecular Weight | 232.03100 |
| Exact Mass | 230.95300 |
| PSA | 66.05000 |
| LogP | 2.89450 |
| InChIKey | BCDDQHXDORNHMC-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(Br)cc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| HS Code | 2908999090 |
|---|
|
~%
2-bromo-5-methy... CAS#:14401-60-6 |
| Literature: TAKEDA SAN DIEGO, INC. Patent: US2009/286800 A1, 2009 ; Location in patent: Page/Page column 109-110 ; US 20090286800 A1 |
|
~%
2-bromo-5-methy... CAS#:14401-60-6 |
| Literature: Kermack; Wight Journal of the Chemical Society, 1935 , p. 1425 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Brom-6-nitro-3-hydroxy-toluol |
| 2-bromo-5-methyl-4-nitro-phenol |
| 1-Methyl-3-hydroxy-4-brom-6-nitro-benzol |
| 3-methyl-4-nitro-6-bromophenol |
| 2-Brom-5-methyl-4-nitro-phenol |