3',5'-Dinitroacetophenone structure
|
Common Name | 3',5'-Dinitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 14401-75-3 | Molecular Weight | 210.14400 | |
| Density | 1.452g/cm3 | Boiling Point | 267.3ºC at 760mmHg | |
| Molecular Formula | C8H6N2O5 | Melting Point | 81-85 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 114.5ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 1-(3,5-dinitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 267.3ºC at 760mmHg |
| Melting Point | 81-85 °C(lit.) |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.14400 |
| Flash Point | 114.5ºC |
| Exact Mass | 210.02800 |
| PSA | 108.71000 |
| LogP | 2.75200 |
| Vapour Pressure | 0.00821mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | WGJQPJOLPLYFJH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R41 |
| Safety Phrases | S28-S36/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
|
~%
3',5'-Dinitroac... CAS#:14401-75-3 |
| Literature: US6037362 A1, ; |
|
~%
3',5'-Dinitroac... CAS#:14401-75-3 |
| Literature: Journal of the American Chemical Society, , vol. 131, # 39 p. 13952 - 13962 |
|
~%
3',5'-Dinitroac... CAS#:14401-75-3 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 21 p. 6952 - 6961 |
|
~%
3',5'-Dinitroac... CAS#:14401-75-3 |
| Literature: Journal of the American Pharmaceutical Association (1912-1977), , vol. 42, p. 176 Yakugaku Zasshi, , vol. 73, p. 392 Chem.Abstr., , p. 3294 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD06796299 |
| 1-acetyl-3,5-dinitrobenzene |
| 3.5-Dinitro-acetophenon |
| 1-(3,5-dinitro-phenyl)-ethanone |
| 1-(3,5-Dinitro-phenyl)-aethanon |
| 3,5-Dinitroacetophenone |