(S)-(-)-2,2-BIS(DI-P-TOLYLPHOSPHINO)-1,1-BINAPHTHYL structure
|
Common Name | (S)-(-)-2,2-BIS(DI-P-TOLYLPHOSPHINO)-1,1-BINAPHTHYL | ||
|---|---|---|---|---|
| CAS Number | 144054-70-6 | Molecular Weight | 269.38100 | |
| Density | 1.061 g/cm3 | Boiling Point | 431ºC at 760 mmHg | |
| Molecular Formula | C18H23NO | Melting Point | 134-137ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 214.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (S)-()-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061 g/cm3 |
|---|---|
| Boiling Point | 431ºC at 760 mmHg |
| Melting Point | 134-137ºC(lit.) |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38100 |
| Flash Point | 214.5ºC |
| Exact Mass | 269.17800 |
| PSA | 46.25000 |
| LogP | 3.99620 |
| Vapour Pressure | 3.41E-08mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | HZIHDWNOPKIOCK-INIZCTEOSA-N |
| SMILES | CC(C)(C)C(N)C(O)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-35-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~63%
(S)-(-)-2,2-BIS... CAS#:144054-70-6 |
| Literature: Korkmaz, Neslihan; Astley, Demet; Astley, Stephen T. Turkish Journal of Chemistry, 2011 , vol. 35, # 3 p. 361 - 374 |
|
~%
(S)-(-)-2,2-BIS... CAS#:144054-70-6 |
| Literature: Korkmaz, Neslihan; Astley, Demet; Astley, Stephen T. Turkish Journal of Chemistry, 2011 , vol. 35, # 3 p. 361 - 374 |
| (S)-(-)-2-Amino-3,3-dimethyl-1,1-diphenyl-1-butanol |
| (2S)-2-amino-3,3-dimethyl-1,1-diphenylbutan-1-ol |
| MFCD03427198 |