5-Bromo-6-chloro-3-indolyl-D-glucuronide cyclohexylammonium salt structure
|
Common Name | 5-Bromo-6-chloro-3-indolyl-D-glucuronide cyclohexylammonium salt | ||
|---|---|---|---|---|
| CAS Number | 144110-43-0 | Molecular Weight | 521.79 | |
| Density | N/A | Boiling Point | 732.2ºC at 760mmHg | |
| Molecular Formula | C20H26BrClN2O7 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 396.6ºC | |
Use of 5-Bromo-6-chloro-3-indolyl-D-glucuronide cyclohexylammonium saltMagenta-β-D-GlcA is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 5-Bromo-6-chloro-3-indolyl β-D-glucuronide cyclohexylammonium salt |
|---|---|
| Synonym | More Synonyms |
| Description | Magenta-β-D-GlcA is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Boiling Point | 732.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C20H26BrClN2O7 |
| Molecular Weight | 521.79 |
| Flash Point | 396.6ºC |
| Exact Mass | 520.061157 |
| PSA | 162.71000 |
| LogP | 0.08110 |
| Vapour Pressure | 1.66E-22mmHg at 25°C |
| InChIKey | HGZDFBMYVMPFHR-CYRSAHDMSA-N |
| SMILES | NC1CCCCC1.O=C(O)C1OC(Oc2c[nH]c3cc(Cl)c(Br)cc23)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Magenta-GlcA Magenta™ glucuronide |
| Cyclohexanamine - 5-bromo-6-chloro-1H-indol-3-yl β-D-glucopyranosiduronic acid (1:1) |
| Magenta-GlcA CHA Salt |
| 5-Bromo-6-chloro-3-indolyl-D-glucuronide cyclohexylammonium salt |
| 5-Bromo-6-chloro-3-indolyl β-D-Glucopyranosiduronic Acid Cyclohexylammonium Salt |
| 5-Bromo-6-chloro-3-indolyl β-D-glucuronide cyclohexylammonium salt |
| MFCD00153929 |
| β-D-Glucopyranosiduronic acid, 5-bromo-6-chloro-1H-indol-3-yl, compd. with cyclohexanamine (1:1) |
| Magenta-Gluc CHA Salt |