1-(3-Chlorophenyl)-4-propylpiperazine structure
|
Common Name | 1-(3-Chlorophenyl)-4-propylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 144146-59-8 | Molecular Weight | 238.75600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-Chlorophenyl)-4-propylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19ClN2 |
|---|---|
| Molecular Weight | 238.75600 |
| Exact Mass | 238.12400 |
| PSA | 6.48000 |
| LogP | 2.87490 |
| InChIKey | GSNOQYGWFHFQEV-UHFFFAOYSA-N |
| SMILES | CCCN1CCN(c2cccc(Cl)c2)CC1 |
|
~85%
1-(3-Chlorophen... CAS#:144146-59-8 |
| Literature: Pettersson, Fredrik; Svensson, Peder; Waters, Susanna; Waters, Nicholas; Sonesson, Clas European Journal of Medicinal Chemistry, 2013 , vol. 62, p. 241 - 255 |
|
~%
1-(3-Chlorophen... CAS#:144146-59-8 |
| Literature: Mokrosz; Pietrasiewicz; Duszynska; Cegla Journal of Medicinal Chemistry, 1992 , vol. 35, # 13 p. 2369 - 2374 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(3-chlorophenyl)-4-propylpiperazine |