2,2,2-trifluoro-N-(2-hydroxy-5-methylphenyl)acetamide structure
|
Common Name | 2,2,2-trifluoro-N-(2-hydroxy-5-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 144181-61-3 | Molecular Weight | 219.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N-(2-hydroxy-5-methylphenyl)acetamide |
|---|
| Molecular Formula | C9H8F3NO2 |
|---|---|
| Molecular Weight | 219.16100 |
| Exact Mass | 219.05100 |
| PSA | 52.82000 |
| LogP | 2.85090 |
| InChIKey | BDDPAXWEOTUNHU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(NC(=O)C(F)(F)F)c1 |
|
~%
2,2,2-trifluoro... CAS#:144181-61-3 |
| Literature: Journal of the American Chemical Society, , vol. 114, # 25 p. 9795 - 9806 |
|
~%
2,2,2-trifluoro... CAS#:144181-61-3 |
| Literature: Journal of Organic Chemistry, , vol. 64, # 11 p. 3825 - 3829 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |