ethyl 2,3-dimethoxy-6-methylbenzoate
ethyl 2,3-dimethoxy-6-methylbenzoate structure
|
Common Name | ethyl 2,3-dimethoxy-6-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 144192-17-6 | Molecular Weight | 224.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 2,3-dimethoxy-6-methylbenzoate, Chinese name 乙基2,3-二甲氧基-6-甲基苯甲酸酯, CAS number 144192-17-6, molecular formula C12H16O4, molecular weight 224.25300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2,3-dimethoxy-6-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O4 |
|---|---|
| Molecular Weight | 224.25300 |
| Exact Mass | 224.10500 |
| PSA | 44.76000 |
| LogP | 2.18890 |
| InChIKey | BPHMRGHPFDJBDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)ccc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
ethyl 2,3-dimet... CAS#:144192-17-6 |
| Literature: Kessar; Singh; Vohra; Kaur; Venugopal Journal of Organic Chemistry, 1992 , vol. 57, # 25 p. 6716 - 6720 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:2934-97-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoic acid,2,3-dimethoxy-6-methyl-,ethyl ester |
| ethyl 2-methyl-5,6-dimethoxybenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: Polar surface area (PSA) of ethyl 2,3-dimethoxy-6-methylbenzoate is 44.76000. |
| Q: What are the upstream materials of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: Related upstream materials(CAS) of ethyl 2,3-dimethoxy-6-methylbenzoate: 104270-87-3. |
| Q: What English synonyms does ethyl 2,3-dimethoxy-6-methylbenzoate have? |
| A: English synonyms of ethyl 2,3-dimethoxy-6-methylbenzoate: Benzoic acid,2,3-dimethoxy-6-methyl-,ethyl ester, ethyl 2-methyl-5,6-dimethoxybenzoate. |
| Q: What is the CAS number of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: CAS number of ethyl 2,3-dimethoxy-6-methylbenzoate is 144192-17-6. |
| Q: What is the molecular weight of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: Molecular weight of ethyl 2,3-dimethoxy-6-methylbenzoate is 224.25300. |
| Q: What is the LogP of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: LogP of ethyl 2,3-dimethoxy-6-methylbenzoate is 2.18890. |
| Q: What is the InChIKey of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: InChIKey of ethyl 2,3-dimethoxy-6-methylbenzoate is BPHMRGHPFDJBDL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: SMILES notation of ethyl 2,3-dimethoxy-6-methylbenzoate is CCOC(=O)c1c(C)ccc(OC)c1OC. |
| Q: What is the Chinese name of 144192-17-6? |
| A: Chinese name of 144192-17-6 is 144192-17-6. |
| Q: What is the English name of ethyl 2,3-dimethoxy-6-methylbenzoate? |
| A: The English name of ethyl 2,3-dimethoxy-6-methylbenzoate is ethyl 2,3-dimethoxy-6-methylbenzoate. |