3-(4-chlorophenyl)-5-methyl-1,3-oxazolidin-2-one structure
|
Common Name | 3-(4-chlorophenyl)-5-methyl-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 14423-08-6 | Molecular Weight | 211.64500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-chlorophenyl)-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10ClNO2 |
|---|---|
| Molecular Weight | 211.64500 |
| Exact Mass | 211.04000 |
| PSA | 29.54000 |
| LogP | 2.75010 |
| InChIKey | IXHNVULJXFVLKD-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccc(Cl)cc2)C(=O)O1 |
|
~90%
3-(4-chlorophen... CAS#:14423-08-6 |
| Literature: Wu, Hua-Yue; Ding, Jin-Chang; Liu, Yun-Kui Journal of the Indian Chemical Society, 2003 , vol. 80, # 1 p. 36 - 37 |
|
~%
3-(4-chlorophen... CAS#:14423-08-6 |
| Literature: Fujiwara, Masahiro; Baba, Akio; Matsuda, Haruo Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1351 - 1357 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-p-Chlorphenyl-5-methyl-2-oxazolidinon |