2-Chloro-4-nitropyridine 1-oxide structure
|
Common Name | 2-Chloro-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 14432-16-7 | Molecular Weight | 174.542 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 405.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C5H3ClN2O3 | Melting Point | 52-56 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 199.3±23.2 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-Chloro-4-nitropyridine N-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.9±25.0 °C at 760 mmHg |
| Melting Point | 52-56 °C(lit.) |
| Molecular Formula | C5H3ClN2O3 |
| Molecular Weight | 174.542 |
| Flash Point | 199.3±23.2 °C |
| Exact Mass | 173.983215 |
| PSA | 71.28000 |
| LogP | 0.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | YSTCMHHKDOVZDA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])c(Cl)c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311-H315-H319-H331-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R23/24/25;R36/37/38 |
| Safety Phrases | S26-S36-S45-S36/37/39-S28 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| HS Code | 2942000000 |
|
~93%
2-Chloro-4-nitr... CAS#:14432-16-7 |
| Literature: Alker, David; Ollis, W. David; Shahriari-Zavareh, Hooshang Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , # 6 p. 1623 - 1630 |
|
~87%
2-Chloro-4-nitr... CAS#:14432-16-7 |
| Literature: CHEMIZON (BEIJING), LTD.; XIAO, Dengming; ZHU, Li; WANG, Shixin; LIANG, Zhi; HU, Wei Patent: WO2010/145197 A1, 2010 ; Location in patent: Page/Page column 79-80 ; WO 2010/145197 A1 |
|
~82%
2-Chloro-4-nitr... CAS#:14432-16-7 |
| Literature: Kureha Kagaku Kogyo Kabushiki Kaisha Patent: US6339045 B1, 2002 ; Location in patent: Referential example 2 ; |
|
~%
2-Chloro-4-nitr... CAS#:14432-16-7 |
| Literature: Tetrahedron, , vol. 55, # 41 p. 11985 - 11996 |
|
~%
2-Chloro-4-nitr... CAS#:14432-16-7 |
| Literature: Journal of the American Chemical Society, , vol. 79, p. 3565 |
|
~%
2-Chloro-4-nitr... CAS#:14432-16-7 |
| Literature: Journal of the American Chemical Society, , vol. 79, p. 3565 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2-Chloro-4-nitropyridine 1-oxide |
| 2-chloro-4-nitro-1-oxidopyridin-1-ium |
| Pyridine, 2-chloro-4-nitro-, 1-oxide |
| EINECS 238-404-6 |
| MFCD00661454 |
| 2-Chloro-4-nitropyridine N-oxide |
| 2-Chloro-4-nitropyridine-1-oxide |
| 2-Chloro-4-nitropyridine-1-oxyde |