5-Oxa-2-azaspiro[3.5]nonane-8-carboxylic acid, 1,6-dioxo-, phenylmethyl ester, (4R,8S)-rel- structure
|
Common Name | 5-Oxa-2-azaspiro[3.5]nonane-8-carboxylic acid, 1,6-dioxo-, phenylmethyl ester, (4R,8S)-rel- | ||
|---|---|---|---|---|
| CAS Number | 144373-57-9 | Molecular Weight | 289.28300 | |
| Density | N/A | Boiling Point | 577.4ºC at 760 mmHg | |
| Molecular Formula | C15H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303ºC | |
| Name | Benzyl (4R,8S)-1,6-dioxo-5-oxa-2-azaspiro[3.5]nonane-8-carboxylate |
|---|
| Boiling Point | 577.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.28300 |
| Flash Point | 303ºC |
| Exact Mass | 289.09500 |
| PSA | 85.19000 |
| LogP | 0.82750 |
| Vapour Pressure | 2.48E-13mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | ZIIFEFCXGIQLOL-IAQYHMDHSA-N |
| SMILES | O=C1CC(C(=O)OCc2ccccc2)CC2(CNC2=O)O1 |
|
~92%
5-Oxa-2-azaspir... CAS#:144373-57-9 |
| Literature: Dolle; McNair; Hughes; Kruse; Eggelston; Saxty; Wells; Groot Journal of Medicinal Chemistry, 1992 , vol. 35, # 26 p. 4875 - 4884 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |