5-Oxa-2-azaspiro[3.5]nonane-8-carboxylic acid, 1,6-dioxo-, (4R,8S)-rel- structure
|
Common Name | 5-Oxa-2-azaspiro[3.5]nonane-8-carboxylic acid, 1,6-dioxo-, (4R,8S)-rel- | ||
|---|---|---|---|---|
| CAS Number | 144373-59-1 | Molecular Weight | 199.16100 | |
| Density | N/A | Boiling Point | 661.7ºC at 760 mmHg | |
| Molecular Formula | C8H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354ºC | |
| Name | (4R,8S)-1,6-Dioxo-5-oxa-2-azaspiro[3.5]nonane-8-carboxylic acid |
|---|
| Boiling Point | 661.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16100 |
| Flash Point | 354ºC |
| Exact Mass | 199.04800 |
| PSA | 96.19000 |
| Vapour Pressure | 3.22E-19mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | CCVGLMFDAMROFT-YJEMDFIKSA-N |
| SMILES | O=C1CC(C(=O)O)CC2(CNC2=O)O1 |
|
~82%
5-Oxa-2-azaspir... CAS#:144373-59-1 |
| Literature: Dolle; McNair; Hughes; Kruse; Eggelston; Saxty; Wells; Groot Journal of Medicinal Chemistry, 1992 , vol. 35, # 26 p. 4875 - 4884 |
|
~%
5-Oxa-2-azaspir... CAS#:144373-59-1 |
| Literature: Dolle; McNair; Hughes; Kruse; Eggelston; Saxty; Wells; Groot Journal of Medicinal Chemistry, 1992 , vol. 35, # 26 p. 4875 - 4884 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |