8-(7-Hydroxy-3,7-dimethyl-2,5-octadienyloxy)psoralen structure
|
Common Name | 8-(7-Hydroxy-3,7-dimethyl-2,5-octadienyloxy)psoralen | ||
|---|---|---|---|---|
| CAS Number | 144398-34-5 | Molecular Weight | 354.396 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 541.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5±30.1 °C | |
| Name | 8-(7-Hydroxy-3,7-dimethyl-2,5-octadienyloxy)psoralen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.9±50.0 °C at 760 mmHg |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.396 |
| Flash Point | 281.5±30.1 °C |
| Exact Mass | 354.146729 |
| PSA | 72.81000 |
| LogP | 4.03 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | YOQCKFCFAJIRRT-OVXNXNIRSA-N |
| SMILES | CC(=CCOc1c2occc2cc2ccc(=O)oc12)CC=CC(C)(C)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-{[(2E,5E)-7-Hydroxy-3,7-dimethyl-2,5-octadien-1-yl]oxy}-7H-furo[3,2-g]chromen-7-one |