Canophyllal structure
|
Common Name | Canophyllal | ||
|---|---|---|---|---|
| CAS Number | 14440-40-5 | Molecular Weight | 440.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H48O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CanophyllalCanophyllal is a triterpene that can be isolated from the leaves of Elsholtzia ciliata. Canophyllal weakly inhibits the production of NO[1]. |
| Name | friedelane-3-one-28-al |
|---|---|
| Synonym | More Synonyms |
| Description | Canophyllal is a triterpene that can be isolated from the leaves of Elsholtzia ciliata. Canophyllal weakly inhibits the production of NO[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H48O2 |
|---|---|
| Molecular Weight | 440.70 |
| Exact Mass | 440.36500 |
| PSA | 34.14000 |
| LogP | 7.63600 |
| InChIKey | ONRNCDHSZVITNY-TWWFCBCGSA-N |
| SMILES | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C=O)CCC12C |
| Storage condition | 2-8℃ |
| canophyllal |
| (4aS,6aR,6bS,8aS,9R,12aS,12bS,14aS,14bS)-2,2,6a,8a,9,12b,14a-Heptamethyl-10-oxo-icosahydro-picene-4a-carbaldehyde |
| Canophyllal |
| 3-oxofriedelan-28-al |