2-Pentenoic acid,2-cyano-3-phenyl-, ethyl ester structure
|
Common Name | 2-Pentenoic acid,2-cyano-3-phenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 14442-48-9 | Molecular Weight | 229.27400 | |
| Density | 1.076g/cm3 | Boiling Point | 342.1ºC at 760mmHg | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | ethyl 2-cyano-3-phenylpent-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 342.1ºC at 760mmHg |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.27400 |
| Flash Point | 162.4ºC |
| Exact Mass | 229.11000 |
| PSA | 50.09000 |
| LogP | 2.93688 |
| Vapour Pressure | 7.7E-05mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | LYBDDDYNWSIADW-OUKQBFOZSA-N |
| SMILES | CCOC(=O)C(C#N)=C(CC)c1ccccc1 |
| HS Code | 2926909090 |
|---|
|
~%
2-Pentenoic aci... CAS#:14442-48-9 |
| Literature: Cope et al. Journal of the American Chemical Society, 1941 , vol. 63, p. 3455 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Aethyl-2-phenyl-1-aethoxycarbonyl-1-cyan-aethylen |
| 2-cyano-3-phenyl-pent-2-enoic acid ethyl ester |
| 2-<1-Phenyl-propyliden>-malonsaeure-aethylester-nitril |
| 2-Cyan-3-phenyl-pent-2-en-saeure-aethylester |