2-Hexenoic acid,2-cyano-3-phenyl-, ethyl ester structure
|
Common Name | 2-Hexenoic acid,2-cyano-3-phenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 14442-66-1 | Molecular Weight | 243.30100 | |
| Density | 1.06g/cm3 | Boiling Point | 356.8ºC at 760mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7ºC | |
| Name | ethyl 2-cyano-3-phenylhex-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 356.8ºC at 760mmHg |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30100 |
| Flash Point | 170.7ºC |
| Exact Mass | 243.12600 |
| PSA | 50.09000 |
| LogP | 3.32698 |
| Vapour Pressure | 2.85E-05mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | PNTUPGXTBBUIRW-BUHFOSPRSA-N |
| SMILES | CCCC(=C(C#N)C(=O)OCC)c1ccccc1 |
|
~%
2-Hexenoic acid... CAS#:14442-66-1 |
| Literature: Cope et al. Journal of the American Chemical Society, 1941 , vol. 63, p. 3455 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Cyan-3-phenyl-but-2-en-saeure |
| 2-cyano-3-phenyl-crotonic acid |
| 2-Cyan-3-phenyl-hex-2-ensaeure-aethylester |
| 2-cyano-3-phenyl-hex-2-enoic acid ethyl ester |
| 2-Cyan-3-phenyl-crotonsaeure |
| 2-Cyano-3-phenyl-2-butenoic acid |