2-Butynedioic acid, bis(1-Methylethyl) ester structure
|
Common Name | 2-Butynedioic acid, bis(1-Methylethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 14447-03-1 | Molecular Weight | 198.21600 | |
| Density | 1.074g/cm3 | Boiling Point | 273.106ºC at 760 mmHg | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.213ºC | |
| Name | dipropan-2-yl but-2-ynedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 273.106ºC at 760 mmHg |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.21600 |
| Flash Point | 115.213ºC |
| Exact Mass | 198.08900 |
| PSA | 52.60000 |
| LogP | 0.89300 |
| Vapour Pressure | 0.006mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | WGYNZBIFSWZNMA-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C#CC(=O)OC(C)C |
| acetylenedicarboxylate to 1c |
| Acetylendicarbonsaeurediisopropylester |
| dimethyl acetylenedicarboxylate |
| Diisopropyl acetylenedicarboxylate |