dipropan-2-yl naphthalene-2,6-dicarboxylate structure
|
Common Name | dipropan-2-yl naphthalene-2,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 141262-30-8 | Molecular Weight | 300.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dipropan-2-yl naphthalene-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20O4 |
|---|---|
| Molecular Weight | 300.34900 |
| Exact Mass | 300.13600 |
| PSA | 52.60000 |
| LogP | 3.97020 |
| InChIKey | WFJXGFNXZIFNPG-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccc2cc(C(=O)OC(C)C)ccc2c1 |
|
~53%
dipropan-2-yl n... CAS#:141262-30-8 |
| Literature: Strey, Karsten; Voes, Juergen Journal of Chemical Research, Miniprint, 1998 , # 3 p. 648 - 682 |
|
~%
dipropan-2-yl n... CAS#:141262-30-8 |
| Literature: Perez-Vazquez, Jaime; Veiga, Alberte X.; Prado, Gustavo; Sardina, F. Javier; Paleo, M. Rita European Journal of Organic Chemistry, 2012 , # 5 p. 975 - 987 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,6-Naphthalenedicarboxylic acid,bis(1-methylethyl) ester |
| diisopropyl naphthalene-2,6-dicarboxylate |