1,2,3,5-tetra-o-acetyl-beta-l-ribofuranose structure
|
Common Name | 1,2,3,5-tetra-o-acetyl-beta-l-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 144490-03-9 | Molecular Weight | 318.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O9 | Melting Point | 80-83ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2S,3S,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 80-83ºC |
|---|---|
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.27700 |
| Exact Mass | 318.09500 |
| PSA | 114.43000 |
| Index of Refraction | 1.514 |
| InChIKey | IHNHAHWGVLXCCI-CYDGBPFRSA-N |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| |A-l-ribofuranose,tetraacetate |
| MFCD00674547 |
| 1,2,3,5-tetra-O-acetyl-L-ribofuranoside |