Tirofiban structure
|
Common Name | Tirofiban | ||
|---|---|---|---|---|
| CAS Number | 144494-65-5 | Molecular Weight | 440.597 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 611.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H36N2O5S | Melting Point | 223-225ºC | |
| MSDS | N/A | Flash Point | 323.7±34.3 °C | |
Use of TirofibanTirofiban(L700462;MK383) is a potent non-peptide, glycoprotein IIb/IIIa (integrins alphaIIbbetaIII) antagonistTarget: integrin IIb/IIIa Tirofiban hydrochloride monohydrate blocks platelet aggregation and thrombus formation. Tirofiban is an antithrombotic used in the treatment of unstable angina.Tirofiban, in a concentration-dependent manner reduced platelet aggregation evoked by ADP (IC50 approximately 70 ng/ml), collagen (IC50 approximately 200 ng/ml), and thrombin (IC50 approximately 5,000 ng/ml). |
| Name | tirofiban |
|---|---|
| Synonym | More Synonyms |
| Description | Tirofiban(L700462;MK383) is a potent non-peptide, glycoprotein IIb/IIIa (integrins alphaIIbbetaIII) antagonistTarget: integrin IIb/IIIa Tirofiban hydrochloride monohydrate blocks platelet aggregation and thrombus formation. Tirofiban is an antithrombotic used in the treatment of unstable angina.Tirofiban, in a concentration-dependent manner reduced platelet aggregation evoked by ADP (IC50 approximately 70 ng/ml), collagen (IC50 approximately 200 ng/ml), and thrombin (IC50 approximately 5,000 ng/ml). |
|---|---|
| Related Catalog | |
| References |
[4]. Valgimigli M, Tebaldi M. Safety evaluation of tirofiban. Expert Opin Drug Saf. 2010 Sep;9(5):801-19. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 611.7±65.0 °C at 760 mmHg |
| Melting Point | 223-225ºC |
| Molecular Formula | C22H36N2O5S |
| Molecular Weight | 440.597 |
| Flash Point | 323.7±34.3 °C |
| Exact Mass | 440.234497 |
| PSA | 113.11000 |
| LogP | 4.14 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | COKMIXFXJJXBQG-NRFANRHFSA-N |
| SMILES | CCCCS(=O)(=O)NC(Cc1ccc(OCCCCC2CCNCC2)cc1)C(=O)O |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S26-S30-S36/37/39-S45 |
| RIDADR | UN3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2942000000 |
|
~99%
Tirofiban CAS#:144494-65-5 |
| Literature: Chung; Zhao; Hughes; Grabowski Tetrahedron, 1993 , vol. 49, # 26 p. 5767 - 5776 |
|
~%
Tirofiban CAS#:144494-65-5 |
| Literature: Tetrahedron, , vol. 49, # 26 p. 5767 - 5776 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2942000000 |
|---|
| Tirofiban [BAN:INN] |
| N-(Butylsulfonyl)-O-[4-(piperidin-4-yl)butyl]-L-tyrosine |
| N-(n-butanesulfonyl)-O-(4-(4-piperidinyl)butyl)-(S)-tyrosine |
| MFCD05237246 |
| 2-S-(n-Butylsulfonylamino)-3[4-(piperidin-4-yl)butyloxyphenyl]propionic acid |
| (S)-2-(butane-1-sulfonylamino)-3-[4-(4-piperidin-4-yl-butoxy)phenyl]-propionic acid |
| Agrastat |
| Agrastat (TN) |
| N-(Butylsulfonyl)-O-[4-(4-piperidinyl)butyl]tyrosine |
| (2S)-2-(butylsulfonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid |
| UNII-GGX234SI5H |
| Aggrastat |
| Tirofiban |
| Tirofiban (INN) |
| Tyrosine, N-(butylsulfonyl)-O-[4-(4-piperidinyl)butyl]- |
| (2S)-2-(butane-1-sulfonamido)-3-{4-[4-(piperidin-4-yl)butoxy]phenyl}propanoic acid |
| N-(BUTYLSULFONYL)-O-[4-(4-PIPERIDINYL)BUTYL]-L-TYROSINE |
| L-tyrosine, N-(butylsulfonyl)-O-[4-(4-piperidinyl)butyl]- |
| L700462 |
| MK383 |