bis[(Z)-octadec-9-enyl] hydrogen phosphate structure
|
Common Name | bis[(Z)-octadec-9-enyl] hydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 14450-07-8 | Molecular Weight | 598.92000 | |
| Density | 0.929g/cm3 | Boiling Point | 651.4ºC at 760mmHg | |
| Molecular Formula | C36H71O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.7ºC | |
| Name | bis[(Z)-octadec-9-enyl] hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929g/cm3 |
|---|---|
| Boiling Point | 651.4ºC at 760mmHg |
| Molecular Formula | C36H71O4P |
| Molecular Weight | 598.92000 |
| Flash Point | 347.7ºC |
| Exact Mass | 598.50900 |
| PSA | 65.57000 |
| LogP | 13.19500 |
| Vapour Pressure | 1.2E-18mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | WFFZELZOEWLYNK-CLFAGFIQSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCCOP(=O)(O)OCCCCCCCCC=CCCCCCCCC |
| HS Code | 2919900090 |
|---|
|
~%
bis[(Z)-octadec... CAS#:14450-07-8 |
| Literature: Kuiper, Johanna M.; Hulst, Ron; Engberts, Jan B. F. N. Synthesis, 2003 , # 5 p. 695 - 698 |
|
~%
bis[(Z)-octadec... CAS#:14450-07-8 |
| Literature: Kuiper, Johanna M.; Hulst, Ron; Engberts, Jan B. F. N. Synthesis, 2003 , # 5 p. 695 - 698 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Dioleyl hydrogen phosphate |
| Dioleoyl phosphate |
| Dioleylphosphat |
| 9-Octadecen-1-ol,hydrogen phosphate,(9Z,9'Z) |
| dioleyl phosphate |
| phosphoric acid di-octadec-9c-enyl ester |
| 9-Octadecen-1-ol,hydrogen phosphate,(Z,Z) |
| EINECS 238-431-3 |
| 9-Octadecen-1-ol,1,1'-(hydrogen phosphate),(9Z,9'Z) |