(5S,6R)-5,6-Diphenylmorpholin-2-on structure
|
Common Name | (5S,6R)-5,6-Diphenylmorpholin-2-on | ||
|---|---|---|---|---|
| CAS Number | 144538-22-7 | Molecular Weight | 253.296 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 444.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3±28.7 °C | |
| Name | (5S,6R)-5,6-Diphenyl-2-morpholinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.0±45.0 °C at 760 mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.296 |
| Flash Point | 222.3±28.7 °C |
| Exact Mass | 253.110275 |
| PSA | 38.33000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | LTPOSIZJPSDSIL-JKSUJKDBSA-N |
| SMILES | O=C1CNC(c2ccccc2)C(c2ccccc2)O1 |
|
~%
(5S,6R)-5,6-Dip... CAS#:144538-22-7 |
| Literature: Journal of Organic Chemistry, , vol. 57, # 24 p. 6527 - 6532 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Morpholinone, 5,6-diphenyl-, (5S,6R)- |
| (5S,6R)-5,6-Diphenylmorpholin-2-on |
| (5S,6R)-5,6-Diphenylmorpholin-2-one |
| (5S,6R)-5,6-Diphenyl-2-morpholinone |