3-(4-phenylanilino)propanoic acid structure
|
Common Name | 3-(4-phenylanilino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 144653-45-2 | Molecular Weight | 241.28500 | |
| Density | 1.195g/cm3 | Boiling Point | 469.9ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238ºC | |
| Name | 3-(4-phenylanilino)propanoic acid |
|---|
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 469.9ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 238ºC |
| Exact Mass | 241.11000 |
| PSA | 49.33000 |
| LogP | 3.31320 |
| Vapour Pressure | 1.24E-09mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | URQKONWODPRUBS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCNc1ccc(-c2ccccc2)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |