4-(2-Carboxyethyl)benzoic Acid Methyl Ester structure
|
Common Name | 4-(2-Carboxyethyl)benzoic Acid Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 151937-09-6 | Molecular Weight | 208.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methoxycarbonylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O4 |
|---|---|
| Molecular Weight | 208.21100 |
| Exact Mass | 208.07400 |
| PSA | 63.60000 |
| LogP | 1.49040 |
| InChIKey | AEPLPTIERJSGES-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CCC(=O)O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-carbomethoxyphenyl)propionic acid |
| Benzenepropanoic acid,4-(methoxycarbonyl) |
| 4-(2-carboxy-ethyl)-benzoic acid methyl ester |
| 3-(4-(methoxycarbonyl)phenyl)propanoic acid |
| 3-(4-(methoxycarbonyl)phenyl)propionic acid |