GAT228 structure
|
Common Name | GAT228 | ||
|---|---|---|---|---|
| CAS Number | 1446648-15-2 | Molecular Weight | 342.391 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 585.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.1±30.1 °C | |
Use of GAT228GAT228, the enantiomer of GAT211, is an allosteric cannabinoid receptor 1 (CB1) ligand[1]. |
| Name | GAT228 |
|---|---|
| Synonym | More Synonyms |
| Description | GAT228, the enantiomer of GAT211, is an allosteric cannabinoid receptor 1 (CB1) ligand[1]. |
|---|---|
| Related Catalog | |
| In Vivo | GAT228 reduces pain scores in response to capsaicin stimulation[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 585.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.391 |
| Flash Point | 308.1±30.1 °C |
| Exact Mass | 342.136841 |
| LogP | 6.23 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | OHZDCJJHWPHZJD-LJQANCHMSA-N |
| SMILES | O=[N+]([O-])CC(c1ccccc1)c1c(-c2ccccc2)[nH]c2ccccc12 |
| 1H-Indole, 3-[(1R)-2-nitro-1-phenylethyl]-2-phenyl- |
| 3-[(1R)-2-Nitro-1-phenylethyl]-2-phenyl-1H-indole |
| R-(+)-3-(2-Nitro-1-phenylethyl)-2-phenyl-1H-indole |
| GAT228 |