4-Quinolinol,5,8-dichloro-2-methyl- structure
|
Common Name | 4-Quinolinol,5,8-dichloro-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 1447-40-1 | Molecular Weight | 228.07500 | |
| Density | 1.39g/cm3 | Boiling Point | 342ºC at 760mmHg | |
| Molecular Formula | C10H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.6ºC | |
| Name | 5,8-dichloro-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 342ºC at 760mmHg |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.07500 |
| Flash Point | 160.6ºC |
| Exact Mass | 226.99000 |
| PSA | 33.12000 |
| LogP | 3.55560 |
| Vapour Pressure | 7.76E-05mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | XVRYYBYRGBLMKT-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2c(Cl)ccc(Cl)c2[nH]1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,8-dichloro-2-methylquinolin-4-ol |
| 5,8-Dichloro-4-hydroxy-2-methylquinoline |
| 5,8-Dichlor-4-hydroxy-chinaldin |