4-Quinolinol,5,8-dimethoxy-2-methyl- structure
|
Common Name | 4-Quinolinol,5,8-dimethoxy-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 58868-03-4 | Molecular Weight | 219.23700 | |
| Density | 1.165g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | 5,8-dimethoxy-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 185.2ºC |
| Exact Mass | 219.09000 |
| PSA | 51.58000 |
| LogP | 2.26600 |
| Index of Refraction | 1.546 |
| InChIKey | UACXXSYLUDAQFM-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c(=O)cc(C)[nH]c12 |
|
~%
4-Quinolinol,5,... CAS#:58868-03-4 |
| Literature: Kaslow; Stayner Journal of the American Chemical Society, 1948 , vol. 70, p. 3350 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| F3284-7426 |
| 5,8-Dimethoxy-2-methyl-4-chinolinol |
| 5,8-Dimethoxy-2-methyl-4-oxo-chinolin |
| 5,8-Dimethoxy-2-methyl-chinolin-4-ol |
| 4-Quinolinol,5,8-dimethoxy-2-methyl |
| 5,8-dimethoxy-2-methyl-quinolin-4-ol |