methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate structure
|
Common Name | methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-c arboxylate | ||
|---|---|---|---|---|
| CAS Number | 144740-59-0 | Molecular Weight | 284.21200 | |
| Density | 1.552g/cm3 | Boiling Point | 410.7ºC at 760 mmHg | |
| Molecular Formula | C8H7F3N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.2ºC | |
| Name | methyl 2-sulfamoyl-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760 mmHg |
| Molecular Formula | C8H7F3N2O4S |
| Molecular Weight | 284.21200 |
| Flash Point | 202.2ºC |
| Exact Mass | 284.00800 |
| PSA | 107.73000 |
| LogP | 2.31550 |
| Vapour Pressure | 5.9E-07mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | NMNFYPVABNEKPU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(F)(F)F)nc1S(N)(=O)=O |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 43-51/53 |
| Safety Phrases | 22-24-37-61 |
|
~58%
methyl 2-aminos... CAS#:144740-59-0 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US5393734 A1, 1995 ; |
| i02-2247 |