4-(Trifluoromethyl)-L-phenylglycine structure
|
Common Name | 4-(Trifluoromethyl)-L-phenylglycine | ||
|---|---|---|---|---|
| CAS Number | 144789-75-3 | Molecular Weight | 219.16100 | |
| Density | 1.415 g/cm3 | Boiling Point | 297.2ºC at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 133.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 4-(Trifluoromethyl)-L-phenylglycine4-(Trifluoromethyl)-L-phenylglycine is a Glycine (HY-Y0966) derivative[1]. |
| Name | 4-(trifluoromethyl)phenylglycine |
|---|
| Description | 4-(Trifluoromethyl)-L-phenylglycine is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.415 g/cm3 |
|---|---|
| Boiling Point | 297.2ºC at 760 mmHg |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16100 |
| Flash Point | 133.6ºC |
| Exact Mass | 219.05100 |
| PSA | 63.32000 |
| LogP | 2.49010 |
| Vapour Pressure | 0.000614mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | FANMQHUKZBBELZ-ZETCQYMHSA-N |
| SMILES | NC(C(=O)O)c1ccc(C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Inhibition of ASCT2 mediated [3H]-D-serine uptake in rat hippocampal astrocytes at 1 ...
Source: ChEMBL
Target: Amino acid transporter
External Id: CHEMBL3992321
|