bis(2,2,6,6-tetramethyl-3,5-heptanedionato)nickel(ii) structure
|
Common Name | bis(2,2,6,6-tetramethyl-3,5-heptanedionato)nickel(ii) | ||
|---|---|---|---|---|
| CAS Number | 14481-08-4 | Molecular Weight | 425.22800 | |
| Density | N/A | Boiling Point | 90-110ºC/0.1mm | |
| Molecular Formula | C22H38NiO4 | Melting Point | 219-223ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 109.7ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one,(E)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one,nickel |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 90-110ºC/0.1mm |
|---|---|
| Melting Point | 219-223ºC(lit.) |
| Molecular Formula | C22H38NiO4 |
| Molecular Weight | 425.22800 |
| Flash Point | 109.7ºC |
| Exact Mass | 424.21200 |
| PSA | 52.60000 |
| LogP | 6.02500 |
| Appearance of Characters | crystal | purple |
| Vapour Pressure | 0.00138mmHg at 25°C |
| InChIKey | LTUQBPCIVSGVNZ-ORWWTJHYSA-N |
| SMILES | CC(C)(C)C(=O)C=C(O)C(C)(C)C.CC(C)(C)C(=O)C=C(O)C(C)(C)C.[Ni] |
| Stability | hygroscopic |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H312-H332-H350 |
| Precautionary Statements | P201-P280-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;Xi: Irritant; |
| Risk Phrases | 45-20/21/22 |
| Safety Phrases | 53-36/37-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Bis(2,2,6,6-tetramethyl-3,5-heptanedionato)nickel(II) |
| MFCD00192348 |