Benzyltriphenylphosphonium bromide structure
|
Common Name | Benzyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 1449-46-3 | Molecular Weight | 433.320 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22BrP | Melting Point | 295-298 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Benzyltriphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 295-298 °C(lit.) |
|---|---|
| Molecular Formula | C25H22BrP |
| Molecular Weight | 433.320 |
| Exact Mass | 432.064240 |
| PSA | 13.59000 |
| LogP | 2.18470 |
| InChIKey | WTEPWWCRWNCUNA-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2931900090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzyl triphenyl phosphonium bromide |
| Benzyltriphenylphosphonium Bromide |
| EINECS 215-908-4 |
| MFCD00031707 |
| (Phenylmethyl)triphenylphosphonium bromide Bromo(benzyl)triphenylphosphorane |
| Phosphonium, triphenyl(phenylmethyl)-, bromide (1:1) |
| Benzyl(triphenyl)phosphonium bromide |
| benzyl(triphenyl)phosphanium,bromide |