Ethyl 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate structure
|
Common Name | Ethyl 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 144927-57-1 | Molecular Weight | 225.632 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 397.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H8ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.9±26.5 °C | |
| Name | Ethyl 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.1±37.0 °C at 760 mmHg |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.632 |
| Flash Point | 193.9±26.5 °C |
| Exact Mass | 225.030502 |
| PSA | 67.87000 |
| LogP | 1.96 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | PCLIRPRTLSCXET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2ncnc(Cl)c12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~76%
Ethyl 4-chloro-... CAS#:144927-57-1 |
| Literature: Mitsubishi Tanabe Pharma Corporation Patent: EP2390254 A1, 2011 ; Location in patent: Page/Page column 67 ; EP 2390254 A1 |
|
~%
Ethyl 4-chloro-... CAS#:144927-57-1 |
| Literature: EP2390254 A1, ; EP 2390254 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, 4-chloro-, ethyl ester |
| ethyl 4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |