1,1,1-Trimethyl-N-phenethyl-N-(trimethylsilyl)silanamine structure
|
Common Name | 1,1,1-Trimethyl-N-phenethyl-N-(trimethylsilyl)silanamine | ||
|---|---|---|---|---|
| CAS Number | 144964-17-0 | Molecular Weight | 265.54200 | |
| Density | 0.883g/cm3 | Boiling Point | 264.544ºC at 760 mmHg | |
| Molecular Formula | C14H27NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1-Trimethyl-N-phenethyl-N-(trimethylsilyl)silanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.883g/cm3 |
|---|---|
| Boiling Point | 264.544ºC at 760 mmHg |
| Molecular Formula | C14H27NSi2 |
| Molecular Weight | 265.54200 |
| Exact Mass | 265.16800 |
| PSA | 3.24000 |
| LogP | 4.20090 |
| Vapour Pressure | 0.01mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | BPSRTBHGLKFZDK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CN(Cc1ccccc1)C[Si](C)(C)C |
|
~97%
1,1,1-Trimethyl... CAS#:144964-17-0 |
| Literature: Pandey, Ganesh; Lakshmaiah, G.; Kumaraswamy, G. Journal of the Chemical Society, Chemical Communications, 1992 , # 18 p. 1313 - 1314 |
| Benzyl-bis-trimethylsilanylmethylamine |
| N,N-Bis[(trimethylsilyl)methyl]benzenemethanamine |