Ethyl 1-benzylpyrrolidine-3-carboxylate structure
|
Common Name | Ethyl 1-benzylpyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5747-92-2 | Molecular Weight | 233.306 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 308.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 107.4±16.8 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | Ethyl 1-Benzylpyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.9±35.0 °C at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.306 |
| Flash Point | 107.4±16.8 °C |
| Exact Mass | 233.141586 |
| PSA | 29.54000 |
| LogP | 2.31 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | CYPXEPWPTXKUPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(Cc2ccccc2)C1 |
| Storage condition | Room temperature. |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyrrolidinecarboxylic acid, 1-(phenylmethyl)-, ethyl ester |
| MFCD04039852 |
| Ethyl-1-benzylpyrrolidin-3-carboxylat |
| Ethyl 1-benzylpyrrolidine-3-carboxylate |
| Ethyl 1-benzyl-3-pyrrolidinecarboxylate |
| Ethyl 1-benzyl-pyrrolidine-3-carboxylate |
| ethyl 1-benzyl pyrrolidine-3-carboxylate |