2,7-Diiodo-9,9-dimethyl-9H-fluorene structure
|
Common Name | 2,7-Diiodo-9,9-dimethyl-9H-fluorene | ||
|---|---|---|---|---|
| CAS Number | 144981-86-2 | Molecular Weight | 446.065 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 446.1±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H12I2 | Melting Point | 195ºC | |
| MSDS | N/A | Flash Point | 229.7±22.3 °C | |
| Name | 2,7-Diiodo-9,9-dimethyl-9H-fluorene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 446.1±38.0 °C at 760 mmHg |
| Melting Point | 195ºC |
| Molecular Formula | C15H12I2 |
| Molecular Weight | 446.065 |
| Flash Point | 229.7±22.3 °C |
| Exact Mass | 445.902832 |
| LogP | 7.26 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | GYOWFFGLGGCYSQ-UHFFFAOYSA-N |
| SMILES | CC1(C)c2cc(I)ccc2-c2ccc(I)cc21 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2903999090 |
|
~45%
2,7-Diiodo-9,9-... CAS#:144981-86-2 |
| Literature: West, Kara; Wang, Changsheng; Batsanov, Andrei S.; Bryce, Martin R. Organic and Biomolecular Chemistry, 2008 , vol. 6, # 11 p. 1934 - 1937 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 9H-Fluorene, 2,7-diiodo-9,9-dimethyl- |
| 2,7-diiodo-9,9-dimethylfluorene |
| 2,7-Diiodo-9,9-dimethyl-9H-fluorene |
| 9,9-Dimethyl-9H-2,7-diiodofluorene |