sodium dehydrocholate structure
|
Common Name | sodium dehydrocholate | ||
|---|---|---|---|---|
| CAS Number | 145-41-5 | Molecular Weight | 424.506 | |
| Density | N/A | Boiling Point | 581.5ºC at 760mmHg | |
| Molecular Formula | C24H33NaO5 | Melting Point | >300°C | |
| MSDS | N/A | Flash Point | 319.5ºC | |
Use of sodium dehydrocholateDehydrocholic sodium is a hydrocholeretic, increasing bile output to clear increased bile acid load. |
| Name | Sodium dehydrocholate |
|---|---|
| Synonym | More Synonyms |
| Description | Dehydrocholic sodium is a hydrocholeretic, increasing bile output to clear increased bile acid load. |
|---|---|
| Related Catalog |
| Boiling Point | 581.5ºC at 760mmHg |
|---|---|
| Melting Point | >300°C |
| Molecular Formula | C24H33NaO5 |
| Molecular Weight | 424.506 |
| Flash Point | 319.5ºC |
| Exact Mass | 424.222565 |
| PSA | 91.34000 |
| LogP | 2.73860 |
| Index of Refraction | 27 ° (C=5, H2O) |
| InChIKey | FKJIJBSJQSMPTI-CAOXKPNISA-M |
| SMILES | CC(CCC(=O)[O-])C1CCC2C3C(=O)CC4CC(=O)CCC4(C)C3CC(=O)C12C.[Na+] |
| Water Solubility | H2O: 0.1 M at 20 °C, clear, colorless |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S22-S36 |
| WGK Germany | 3 |
| RTECS | FZ2500000 |
|
Name: Identifying Sarm1 Tir Hydrolase inhibitors through NAD-Glo assay
Source: 24386
Target: N/A
External Id: Sarm1 Tir NADase inhibitors screen
|
|
Name: Enzymatic assay of human HDAC6 with commercial peptide substrate
Source: ChEMBL
Target: Histone deacetylase 6
External Id: CHEMBL4808149
|
|
Name: ERK5 transcriptional activity HTS
Source: 24565
Target: N/A
External Id: ERK5 transcriptional activity-HTS
|
|
Name: Enzymatic assay of human HDAC6 with custom peptide substrate
Source: ChEMBL
Target: Histone deacetylase 6
External Id: CHEMBL4808150
|
|
Name: Antiviral activity determined as inhibition of SARS-CoV-2 induced cytotoxicity of VER...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4513082
|
|
Name: Antiviral activity determined as inhibition of SARS-CoV-2 induced cytotoxicity of Cac...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4303805
|
|
Name: SARS-CoV-2 3CL-Pro protease inhibition percentage at 20µM by FRET kind of response f...
Source: ChEMBL
Target: Replicase polyprotein 1ab
External Id: CHEMBL4495582
|
|
Name: Human Phosphogluconate dehydrogenase (6PGD) Inhibitor Screening
Source: 11827
Target: Phosphogluconate dehydrogenase
External Id: 6PGD_Inhibitor_Screening_2015_09
|
| Dycholium |
| Dehydrocholic acid sodium salt |
| 3,7,12-Trioxo-5b-cholan-24-oic Acid Monosodium Salt |
| Biliton |
| Biliron |
| 3,7,12-Trioxo-5b-cholan-24-oic Acid Sodium Salt |
| Natriumdehydrocholat |
| Decholin sodium salt |
| sodium dehydrocholate |
| (5b)-3,7,12-Trioxocholan-24-oic Acid Sodium Salt |
| SodiuMDehydrocholic |
| Sodium (5β)-3,7,12-trioxocholan-24-oate |
| Carachol |
| dilabilsodium |
| decholinsodium |
| MFCD00150750 |
| Sodium 3,7,12-Trioxo-5b-cholan-24-oate |
| Sodium 3,7,12-triketocholanate |
| Dehydrocholate sodium |
| Sodium 3,7,12-Trioxo-5b-cholanate |
| dehydrocholic acid monosodium salt |
| Cholan-24-oic acid, 3,7,12-trioxo-, sodium salt, (5β)- (1:1) |
| Dilabil sodium |
| Sodium 3,7,12-trioxo-5β-cholan-24-oate |
| Decholin sodium |
| EINECS 205-652-1 |
| decholinsodiumsalt |
| BILITON SODIUM SALT |
| Suprachol |
| Dehydrocholate (sodium) |