1-(2-Hydroxy-5-nitrophenyl)ethanone structure
|
Common Name | 1-(2-Hydroxy-5-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 1450-76-6 | Molecular Weight | 181.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 285.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 100-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 126.0±11.6 °C | |
| Name | 2'-Hydroxy-5'-nitroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.5±25.0 °C at 760 mmHg |
| Melting Point | 100-104 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 126.0±11.6 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | LNCBPUWMGYOISS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc([N+](=O)[O-])ccc1O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| Ethanone, 1-(2-hydroxy-5-nitrophenyl)- |
| 1-(2-Hydroxy-5-nitrophenyl)ethanone |
| MFCD00463816 |