2-Cyclohexene-1,4-dione,2,3,5,5,6,6-hexachloro structure
|
Common Name | 2-Cyclohexene-1,4-dione,2,3,5,5,6,6-hexachloro | ||
|---|---|---|---|---|
| CAS Number | 14504-09-7 | Molecular Weight | 316.78100 | |
| Density | 1.89g/cm3 | Boiling Point | 290.5ºC at 760mmHg | |
| Molecular Formula | C6Cl6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.4ºC | |
| Name | 2,3,5,5,6,6-hexachlorocyclohex-2-ene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 290.5ºC at 760mmHg |
| Molecular Formula | C6Cl6O2 |
| Molecular Weight | 316.78100 |
| Flash Point | 121.4ºC |
| Exact Mass | 313.80300 |
| PSA | 34.14000 |
| LogP | 3.17520 |
| Vapour Pressure | 0.00206mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | OGCXHDIKDLDDTC-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C(Cl)(Cl)C1(Cl)Cl |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| Hexachlor-cyclohex-2-en-1,4-dion |
| 2,3,5,5,6,6-Hexachlorocyclohexene-1,4-dione |
| 2,3,5,5,6,6-hexachloro-2-cyclohexene-1,4-dione |
| Hexachlor-1-cyclohexen-3,6-dion |
| F0433-0228 |
| hexachloro-cyclohex-2-ene-1,4-dione |